 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3ncnc(NCc4occc4)c3nc2)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C15H18N5O8P/c21-11-9(5-27-29(23,24)25)28-15(12(11)22)20-7-19-10-13(17-6-18-14(10)20)16-4-8-2-1-3-26-8/h1-3,6-7,9,11-12,15,21-22H,4-5H2,(H,16,17,18)(H2,23,24,25)/p-2/t9-,11+,12-,15+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=16.2773 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 425.294 g/mol | logS: -2.48835 | SlogP: -2.2124 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0283972 | Sterimol/B1: 2.73654 | Sterimol/B2: 3.03139 | Sterimol/B3: 3.77058 | |||
| Sterimol/B4: 6.43478 | Sterimol/L: 20.8626 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 631.463 | Positive charged surface: 364.654 | Negative charged surface: 266.809 | Volume: 334.625 | |||
| Hydrophobic surface: 352.052 | Hydrophilic surface: 279.411 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
