 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3ncnc(NCc4ccccc4)c3nc2)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C17H19N5O7P/c23-13-11(7-28-30(25,26)27)29-17(14(13)24)22-9-21-12-15(19-8-20-16(12)22)18-6-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,23H,6-7H2,(H,18,19,20)(H2,25,26,27)/q-1/p-2/t11-,13+,14-,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=78.8918 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 434.325 g/mol | logS: -2.8083 | SlogP: -1.3672 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0554649 | Sterimol/B1: 3.34808 | Sterimol/B2: 3.67786 | Sterimol/B3: 4.93289 | |||
| Sterimol/B4: 7.45476 | Sterimol/L: 20.304 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 677.022 | Positive charged surface: 362.145 | Negative charged surface: 314.876 | Volume: 356.375 | |||
| Hydrophobic surface: 365.451 | Hydrophilic surface: 311.571 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
