Type: Neutral
Formula: C13H19N3O6S2
SMILES: |
S(=O)(CC(NC(=O)\C=C\C=1C(=O)NC(=O)NC=1C)CO)CS(=O)C |
InChI: |
InChI=1/C13H19N3O6S2/c1-8-10(12(19)16-13(20)14-8)3-4-11(18)15-9(5-17)6-24(22)7-23(2)21/h3-4,9,17H,5-7H2,1-2H3,(H,15,18)(H2,14,16,19,20)/b4-3+/t9-,23+,24+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 377.442 g/mol | logS: -1.43145 | SlogP: -1.7822 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0708095 | Sterimol/B1: 2.17758 | Sterimol/B2: 5.04318 | Sterimol/B3: 5.45071 |
Sterimol/B4: 5.88001 | Sterimol/L: 17.4319 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 623.515 | Positive charged surface: 387.577 | Negative charged surface: 235.938 | Volume: 313.125 |
Hydrophobic surface: 329.934 | Hydrophilic surface: 293.581 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |