 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C([O-])C1n1ncc2c1ncnc2Nc1ccccc1 |
| InChI: | InChI=1/C16H16N5O4/c22-7-11-12(23)13(24)16(25-11)21-15-10(6-19-21)14(17-8-18-15)20-9-4-2-1-3-5-9/h1-6,8,11-13,16,22-23H,7H2,(H,17,18,20)/q-1/t11-,12+,13-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.828 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 342.335 g/mol | logS: -2.79666 | SlogP: 0.7151 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0274097 | Sterimol/B1: 3.21495 | Sterimol/B2: 3.4235 | Sterimol/B3: 4.19189 | |||
| Sterimol/B4: 5.34741 | Sterimol/L: 17.418 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 558.586 | Positive charged surface: 357.868 | Negative charged surface: 194.408 | Volume: 302.375 | |||
| Hydrophobic surface: 371.568 | Hydrophilic surface: 187.018 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
