Type: Neutral
Formula: C10H14N6O4
SMILES: |
O1C(CO)C(O)C(N)C1n1c2N=C(NC(=O)c2nc1)N |
InChI: |
InChI=1/C10H14N6O4/c11-4-6(18)3(1-17)20-9(4)16-2-13-5-7(16)14-10(12)15-8(5)19/h2-4,6,9,17-18H,1,11H2,(H3,12,14,15,19)/t3-,4+,6+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 282.26 g/mol | logS: -0.55956 | SlogP: -2.7539 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.106424 | Sterimol/B1: 2.33362 | Sterimol/B2: 3.80054 | Sterimol/B3: 3.96512 |
Sterimol/B4: 5.9709 | Sterimol/L: 13.4931 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 470.906 | Positive charged surface: 348.854 | Negative charged surface: 122.052 | Volume: 232.875 |
Hydrophobic surface: 153.238 | Hydrophilic surface: 317.668 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |