Type: Neutral
Formula: C14H21N3O5S
SMILES: |
S(=O)(C(C)C)CC(NC(=O)\C=C\C=1C(=O)NC(=O)NC=1C)CO |
InChI: |
InChI=1/C14H21N3O5S/c1-8(2)23(22)7-10(6-18)16-12(19)5-4-11-9(3)15-14(21)17-13(11)20/h4-5,8,10,18H,6-7H2,1-3H3,(H,16,19)(H2,15,17,20,21)/b5-4+/t10-,23-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 343.404 g/mol | logS: -2.11972 | SlogP: -0.7098 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0805657 | Sterimol/B1: 2.4875 | Sterimol/B2: 4.27739 | Sterimol/B3: 5.3807 |
Sterimol/B4: 5.57319 | Sterimol/L: 16.2487 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 586.677 | Positive charged surface: 384.945 | Negative charged surface: 201.732 | Volume: 304.875 |
Hydrophobic surface: 309.182 | Hydrophilic surface: 277.495 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |