Type: Neutral
Formula: C14H19NO5
SMILES: |
O1C(C)C(NC(=O)c2ccccc2)C(O)C(O)C1CO |
InChI: |
InChI=1/C14H19NO5/c1-8-11(13(18)12(17)10(7-16)20-8)15-14(19)9-5-3-2-4-6-9/h2-6,8,10-13,16-18H,7H2,1H3,(H,15,19)/t8-,10-,11+,12+,13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.308 g/mol | logS: -1.54208 | SlogP: -0.7136 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0995662 | Sterimol/B1: 1.969 | Sterimol/B2: 2.40534 | Sterimol/B3: 5.16238 |
Sterimol/B4: 5.77668 | Sterimol/L: 15.9008 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 504.896 | Positive charged surface: 323.594 | Negative charged surface: 181.302 | Volume: 262.75 |
Hydrophobic surface: 314.474 | Hydrophilic surface: 190.422 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |