Type: Neutral
Formula: C12H15N7O4
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C=2C1=N/C(/NC=2N)=N\N)C#N |
InChI: |
InChI=1/C12H15N7O4/c13-1-4-2-19(11-8(22)7(21)5(3-20)23-11)10-6(4)9(14)16-12(17-10)18-15/h2,5,7-8,11,20-22H,3,15H2,(H3,14,16,17,18)/t5-,7+,8+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.297 g/mol | logS: -1.01119 | SlogP: -3.44982 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0731403 | Sterimol/B1: 2.80946 | Sterimol/B2: 3.61165 | Sterimol/B3: 4.05816 |
Sterimol/B4: 8.73273 | Sterimol/L: 12.7133 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.818 | Positive charged surface: 371.14 | Negative charged surface: 147.678 | Volume: 267.375 |
Hydrophobic surface: 142.757 | Hydrophilic surface: 376.061 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |