Type: Neutral
Formula: C14H21N4O6P
SMILES: |
P(OCC1OC(N2C=C(C)C(=O)NC2=O)CC1O)(=O)(N1CC1)N1CC1 |
InChI: |
InChI=1/C14H21N4O6P/c1-9-7-18(14(21)15-13(9)20)12-6-10(19)11(24-12)8-23-25(22,16-2-3-16)17-4-5-17/h7,10-12,19H,2-6,8H2,1H3,(H,15,20,21)/t10-,11-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 372.318 g/mol | logS: -0.10515 | SlogP: -1.3964 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.152987 | Sterimol/B1: 2.43574 | Sterimol/B2: 2.62887 | Sterimol/B3: 6.18573 |
Sterimol/B4: 7.74294 | Sterimol/L: 15.5231 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 599.706 | Positive charged surface: 359.317 | Negative charged surface: 240.39 | Volume: 319 |
Hydrophobic surface: 403.163 | Hydrophilic surface: 196.543 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |