 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2C3N(CC(O)(C(C3)CC)c3ccccc3)CCc2cc1OC |
| InChI: | InChI=1/C23H29NO3/c1-4-17-13-20-19-14-22(27-3)21(26-2)12-16(19)10-11-24(20)15-23(17,25)18-8-6-5-7-9-18/h5-9,12,14,17,20,25H,4,10-11,13,15H2,1-3H3/t17-,20+,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=148.617 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 367.489 g/mol | logS: -4.37569 | SlogP: 4.32767 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.273656 | Sterimol/B1: 2.22265 | Sterimol/B2: 3.90848 | Sterimol/B3: 5.85783 | |||
| Sterimol/B4: 9.26118 | Sterimol/L: 14.4655 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 612.496 | Positive charged surface: 456.233 | Negative charged surface: 156.263 | Volume: 371.875 | |||
| Hydrophobic surface: 537.74 | Hydrophilic surface: 74.756 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
