Type: Neutral
Formula: C21H28O4
SMILES: |
OC1(CCC2C3C(CC(=O)C12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C |
InChI: |
InChI=1/C21H28O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)17(15)11-18(24)20(16,21)3/h10,15-17,25H,4-9,11H2,1-3H3/t15-,16+,17-,19-,20-,21-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.451 g/mol | logS: -3.66576 | SlogP: 3.0174 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.144082 | Sterimol/B1: 2.81823 | Sterimol/B2: 3.34642 | Sterimol/B3: 4.79422 |
Sterimol/B4: 5.96596 | Sterimol/L: 14.9565 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 525.014 | Positive charged surface: 328.717 | Negative charged surface: 196.296 | Volume: 334.125 |
Hydrophobic surface: 379.065 | Hydrophilic surface: 145.949 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |