Type: Neutral
Formula: C15H19NO6S
SMILES: |
S=C(OC1C(O)C2OC(OCC2OC1OC)c1ccccc1)N |
InChI: |
InChI=1/C15H19NO6S/c1-18-14-12(22-15(16)23)10(17)11-9(20-14)7-19-13(21-11)8-5-3-2-4-6-8/h2-6,9-14,17H,7H2,1H3,(H2,16,23)/t9-,10+,11-,12-,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 341.384 g/mol | logS: -3.19437 | SlogP: 0.5571 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0487503 | Sterimol/B1: 2.28328 | Sterimol/B2: 2.54707 | Sterimol/B3: 4.887 |
Sterimol/B4: 6.85646 | Sterimol/L: 16.3473 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 568.651 | Positive charged surface: 384.165 | Negative charged surface: 184.486 | Volume: 297 |
Hydrophobic surface: 382.052 | Hydrophilic surface: 186.599 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |