Type: Neutral
Formula: C11H19N3O5S
SMILES: |
S(C(N1C=CC(=NC1=O)N)C(O)C(O)C(O)CO)CC |
InChI: |
InChI=1/C11H19N3O5S/c1-2-20-10(9(18)8(17)6(16)5-15)14-4-3-7(12)13-11(14)19/h3-4,6,8-10,15-18H,2,5H2,1H3,(H2,12,13,19)/t6-,8-,9-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.355 g/mol | logS: -0.89748 | SlogP: -1.5529 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0988801 | Sterimol/B1: 1.969 | Sterimol/B2: 3.65453 | Sterimol/B3: 4.06524 |
Sterimol/B4: 7.56169 | Sterimol/L: 15.0324 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.63 | Positive charged surface: 329.343 | Negative charged surface: 173.286 | Volume: 265.5 |
Hydrophobic surface: 185.918 | Hydrophilic surface: 316.712 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |