Type: Neutral
Formula: C15H18N2O5
SMILES: |
O1C2C3N(C3C(OC2COC1c1ccccc1)OC)C(=O)N |
InChI: |
InChI=1/C15H18N2O5/c1-19-14-11-10(17(11)15(16)18)12-9(21-14)7-20-13(22-12)8-5-3-2-4-6-8/h2-6,9-14H,7H2,1H3,(H2,16,18)/t9-,10+,11-,12-,13-,14+,17?/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.318 g/mol | logS: -2.15077 | SlogP: 0.6989 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.121786 | Sterimol/B1: 2.48931 | Sterimol/B2: 3.19119 | Sterimol/B3: 5.716 |
Sterimol/B4: 6.09652 | Sterimol/L: 14.4434 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 515.356 | Positive charged surface: 366.913 | Negative charged surface: 148.443 | Volume: 279 |
Hydrophobic surface: 400.376 | Hydrophilic surface: 114.98 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |