Type: Neutral
Formula: C16H21NO6
SMILES: |
O1C2C(OC(OC2)c2ccccc2)C(NC(=O)C)C(O)C1OC |
InChI: |
InChI=1/C16H21NO6/c1-9(18)17-12-13(19)16(20-2)22-11-8-21-15(23-14(11)12)10-6-4-3-5-7-10/h3-7,11-16,19H,8H2,1-2H3,(H,17,18)/t11-,12-,13-,14-,15+,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.345 g/mol | logS: -1.96553 | SlogP: 0.433 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.162511 | Sterimol/B1: 1.99135 | Sterimol/B2: 3.77872 | Sterimol/B3: 4.05282 |
Sterimol/B4: 9.60316 | Sterimol/L: 12.3879 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 535.626 | Positive charged surface: 380.018 | Negative charged surface: 155.608 | Volume: 296.125 |
Hydrophobic surface: 425.504 | Hydrophilic surface: 110.122 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |