 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1cc(NC(Nc2nc(cc(n2)NCC2CCN(C2)CC)C)=N)ccc1Cl |
| InChI: | InChI=1/C19H25Cl2N7/c1-3-28-7-6-13(11-28)10-23-17-8-12(2)24-19(26-17)27-18(22)25-14-4-5-15(20)16(21)9-14/h4-5,8-9,13H,3,6-7,10-11H2,1-2H3,(H4,22,23,24,25,26,27)/t13-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=14.2971 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 422.364 g/mol | logS: -5.49914 | SlogP: 4.30429 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0170248 | Sterimol/B1: 2.86766 | Sterimol/B2: 3.12949 | Sterimol/B3: 3.66835 | |||
| Sterimol/B4: 6.43557 | Sterimol/L: 23.3776 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 712.194 | Positive charged surface: 447.717 | Negative charged surface: 264.477 | Volume: 390.125 | |||
| Hydrophobic surface: 554.688 | Hydrophilic surface: 157.506 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
