 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C[NH3+])C(O)C(O)C(NC(=O)c2ccccc2)C1OC1C(O)C(O)C([NH3+])C C1[NH3+] |
| InChI: | InChI=1/C19H30N4O7/c20-7-11-14(25)15(26)12(23-18(28)8-4-2-1-3-5-8)19(29-11)30-17-10(22)6-9(21)13(24)16(17)27/h1-5,9-17,19,24-27H,6-7,20-22H2,(H,23,28)/p+3/t9-,10+,11-,12+,13-,14+,15+,16-,17+,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=120.063 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 429.494 g/mol | logS: -0.38722 | SlogP: -5.7947 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.333457 | Sterimol/B1: 2.38105 | Sterimol/B2: 3.95906 | Sterimol/B3: 5.98648 | |||
| Sterimol/B4: 10.7896 | Sterimol/L: 13.0377 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 644.204 | Positive charged surface: 511.703 | Negative charged surface: 132.501 | Volume: 395.125 | |||
| Hydrophobic surface: 352.206 | Hydrophilic surface: 291.998 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 10 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
