 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C(=O)C)C1C(O)C(O)C(NC(OCc2ccccc2)=O)CC1NC(OCc1ccccc1)=O |
| InChI: | InChI=1/C24H28N2O8/c1-15(27)34-22-19(26-24(31)33-14-17-10-6-3-7-11-17)12-18(20(28)21(22)29)25-23(30)32-13-16-8-4-2-5-9-16/h2-11,18-22,28-29H,12-14H2,1H3,(H,25,30)(H,26,31)/t18-,19-,20-,21-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=62.9602 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 472.494 g/mol | logS: -3.98618 | SlogP: 2.1664 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0625217 | Sterimol/B1: 2.48262 | Sterimol/B2: 3.42788 | Sterimol/B3: 4.57807 | |||
| Sterimol/B4: 12.9035 | Sterimol/L: 20.0562 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 813.089 | Positive charged surface: 508.293 | Negative charged surface: 304.796 | Volume: 438 | |||
| Hydrophobic surface: 600.356 | Hydrophilic surface: 212.733 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.