 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1C(CCN(C(=O)c2ccccc2)C1Cc1c2c([nH]c1)cccc2)CC(=O)[O-] |
| InChI: | InChI=1/C23H24N2O4/c26-21(27)13-16-10-11-25(23(29)15-6-2-1-3-7-15)20(22(16)28)12-17-14-24-19-9-5-4-8-18(17)19/h1-9,14,16,20,22,24,28H,10-13H2,(H,26,27)/p-1/t16-,20+,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=76.1305 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 391.447 g/mol | logS: -3.9069 | SlogP: 1.74217 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.106012 | Sterimol/B1: 3.48441 | Sterimol/B2: 4.24538 | Sterimol/B3: 4.5607 | |||
| Sterimol/B4: 9.22093 | Sterimol/L: 16.493 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 635.699 | Positive charged surface: 354.478 | Negative charged surface: 277.05 | Volume: 376.25 | |||
| Hydrophobic surface: 451.367 | Hydrophilic surface: 184.332 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
