Type: Neutral
Formula: C9H14N4O5
SMILES: |
O1C(CO)C(O)C(O)C1n1nc(N)c(c1)C(=O)N |
InChI: |
InChI=1/C9H14N4O5/c10-7-3(8(11)17)1-13(12-7)9-6(16)5(15)4(2-14)18-9/h1,4-6,9,14-16H,2H2,(H2,10,12)(H2,11,17)/t4-,5+,6+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.234 g/mol | logS: 0.43622 | SlogP: -2.7288 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0802003 | Sterimol/B1: 3.15464 | Sterimol/B2: 3.71932 | Sterimol/B3: 3.94203 |
Sterimol/B4: 4.797 | Sterimol/L: 12.6499 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 453.644 | Positive charged surface: 330.049 | Negative charged surface: 123.594 | Volume: 214.5 |
Hydrophobic surface: 124.114 | Hydrophilic surface: 329.53 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |