 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C)C(NC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1C=CC(=NC1=O)NC(=O)C |
| InChI: | InChI=1/C18H24N4O8/c1-8-14(20-10(3)24)15(29-11(4)25)16(30-12(5)26)17(28-8)22-7-6-13(19-9(2)23)21-18(22)27/h6-8,14-17H,1-5H3,(H,20,24)(H,19,21,23,27)/t8-,14-,15-,16-,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=131.634 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.41 g/mol | logS: -2.30691 | SlogP: -0.4168 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.279639 | Sterimol/B1: 2.34596 | Sterimol/B2: 3.85883 | Sterimol/B3: 7.01936 | |||
| Sterimol/B4: 9.41507 | Sterimol/L: 14.6444 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 628.852 | Positive charged surface: 383.449 | Negative charged surface: 245.403 | Volume: 365.75 | |||
| Hydrophobic surface: 421.805 | Hydrophilic surface: 207.047 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.