Type: Neutral
Formula: C16H22N2O6
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(O)C)C(=O)NC(C(OC)=O)C |
InChI: |
InChI=1/C16H22N2O6/c1-10(15(21)23-3)17-14(20)13(11(2)19)18-16(22)24-9-12-7-5-4-6-8-12/h4-8,10-11,13,19H,9H2,1-3H3,(H,17,20)(H,18,22)/t10-,11+,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 338.36 g/mol | logS: -2.64045 | SlogP: 0.6063 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0550738 | Sterimol/B1: 2.56133 | Sterimol/B2: 2.67974 | Sterimol/B3: 4.76556 |
Sterimol/B4: 8.00209 | Sterimol/L: 19.2689 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 622.172 | Positive charged surface: 425.15 | Negative charged surface: 197.022 | Volume: 318.125 |
Hydrophobic surface: 430.681 | Hydrophilic surface: 191.491 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |