 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1C2C3CCC(C(CCCC(C)C)C)C3(CCC2C2(C(CC(CC2)c2ccccc2)=C1)C)C |
| InChI: | InChI=1/C33H48O/c1-22(2)10-9-11-23(3)27-14-15-28-31-29(17-19-33(27,28)5)32(4)18-16-25(20-26(32)21-30(31)34)24-12-7-6-8-13-24/h6-8,12-13,21-23,25,27-29,31H,9-11,14-20H2,1-5H3/t23-,25+,27+,28+,29-,31-,32+,33-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=206.466 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 460.746 g/mol | logS: -12.373 | SlogP: 8.9906 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0606293 | Sterimol/B1: 3.77208 | Sterimol/B2: 3.80964 | Sterimol/B3: 4.67644 | |||
| Sterimol/B4: 6.61844 | Sterimol/L: 23.3299 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 767.654 | Positive charged surface: 524.633 | Negative charged surface: 243.021 | Volume: 503.375 | |||
| Hydrophobic surface: 652.922 | Hydrophilic surface: 114.732 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 0 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 8 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.