 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NCc1ccccc1)C1CC2C(N(C1)C)Cc1c3c2cccc3[nH]c1 |
| InChI: | InChI=1/C23H25N3O/c1-26-14-17(23(27)25-12-15-6-3-2-4-7-15)10-19-18-8-5-9-20-22(18)16(13-24-20)11-21(19)26/h2-9,13,17,19,21,24H,10-12,14H2,1H3,(H,25,27)/t17-,19-,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=82.1522 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 359.473 g/mol | logS: -3.71369 | SlogP: 3.71067 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0363009 | Sterimol/B1: 2.01814 | Sterimol/B2: 3.49107 | Sterimol/B3: 3.59845 | |||
| Sterimol/B4: 8.49133 | Sterimol/L: 18.8004 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 626.375 | Positive charged surface: 420.762 | Negative charged surface: 201.141 | Volume: 361.375 | |||
| Hydrophobic surface: 531.236 | Hydrophilic surface: 95.139 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
