 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1c2c(OCC1CN1CCC3(N(c4ccccc4)C(=O)N=C3NC3CCCCC3)CC1)cccc2 |
| InChI: | InChI=1/C28H34N4O3/c33-27-30-26(29-21-9-3-1-4-10-21)28(32(27)22-11-5-2-6-12-22)15-17-31(18-16-28)19-23-20-34-24-13-7-8-14-25(24)35-23/h2,5-8,11-14,21,23H,1,3-4,9-10,15-20H2,(H,29,30,33)/t23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=520.005 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 474.605 g/mol | logS: -5.91847 | SlogP: 4.622 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0538172 | Sterimol/B1: 2.9604 | Sterimol/B2: 3.25182 | Sterimol/B3: 4.34881 | |||
| Sterimol/B4: 12.4442 | Sterimol/L: 18.6578 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 751.27 | Positive charged surface: 516.3 | Negative charged surface: 234.97 | Volume: 453.625 | |||
| Hydrophobic surface: 679.879 | Hydrophilic surface: 71.391 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.