Type: Neutral
Formula: C13H17N5O4S
SMILES: |
S(C)c1nc(nc2n(cnc12)C1OC(CO)C(O)C1)NC(=O)C |
InChI: |
InChI=1/C13H17N5O4S/c1-6(20)15-13-16-11-10(12(17-13)23-2)14-5-18(11)9-3-7(21)8(4-19)22-9/h5,7-9,19,21H,3-4H2,1-2H3,(H,15,16,17,20)/t7-,8+,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 339.376 g/mol | logS: -3.4787 | SlogP: 0.2428 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0443995 | Sterimol/B1: 2.32995 | Sterimol/B2: 3.14984 | Sterimol/B3: 3.72751 |
Sterimol/B4: 8.37319 | Sterimol/L: 15.9241 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 571.514 | Positive charged surface: 400.711 | Negative charged surface: 170.803 | Volume: 292.875 |
Hydrophobic surface: 320.554 | Hydrophilic surface: 250.96 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |