 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC12C(Cc3c(C1=O)c(O)c1c(cccc1O)c3C)C([NH+](C)C)C(O)C(C(=O)N) =C2O |
| InChI: | InChI=1/C22H24N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,16,18,25-27,29,31H,7H2,1-3H3,(H2,23,30)/p+1/t11-,16+,18+,22+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=76.5247 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 429.449 g/mol | logS: -3.6632 | SlogP: -1.16951 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0866316 | Sterimol/B1: 2.52528 | Sterimol/B2: 3.94347 | Sterimol/B3: 4.19395 | |||
| Sterimol/B4: 8.00622 | Sterimol/L: 15.8885 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 601.122 | Positive charged surface: 399.912 | Negative charged surface: 191.4 | Volume: 379.625 | |||
| Hydrophobic surface: 325.212 | Hydrophilic surface: 275.91 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
