Type: Neutral
Formula: C17H24N2O6
SMILES: |
O1C2C(OC(OC2)c2ccccc2)C(O)C(N(C(=O)NC)C)C1OC |
InChI: |
InChI=1/C17H24N2O6/c1-18-17(21)19(2)12-13(20)14-11(24-16(12)22-3)9-23-15(25-14)10-7-5-4-6-8-10/h4-8,11-16,20H,9H2,1-3H3,(H,18,21)/t11-,12-,13+,14+,15+,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 352.387 g/mol | logS: -1.6934 | SlogP: 0.5681 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104961 | Sterimol/B1: 2.15889 | Sterimol/B2: 3.6787 | Sterimol/B3: 4.29873 |
Sterimol/B4: 8.9991 | Sterimol/L: 15.4104 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.572 | Positive charged surface: 461.88 | Negative charged surface: 126.693 | Volume: 325.875 |
Hydrophobic surface: 501.017 | Hydrophilic surface: 87.555 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |