 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(SCC(NC(=O)c1ccccc1)C(=O)[O-])CC(NC(=O)c1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C20H20N2O6S2/c23-17(13-7-3-1-4-8-13)21-15(19(25)26)11-29-30-12-16(20(27)28)22-18(24)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,21,23)(H,22,24)(H,25,26)(H,27,28)/p-2/t15-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=85.0494 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 446.504 g/mol | logS: -6.07974 | SlogP: -0.5352 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.279932 | Sterimol/B1: 3.24623 | Sterimol/B2: 4.07371 | Sterimol/B3: 7.23949 | |||
| Sterimol/B4: 7.67242 | Sterimol/L: 15.124 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 688.433 | Positive charged surface: 329.231 | Negative charged surface: 359.202 | Volume: 389.625 | |||
| Hydrophobic surface: 434.649 | Hydrophilic surface: 253.784 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
