Type: Neutral
Formula: C11H15N5O4
SMILES: |
O1C(CO)C(O)C(O)C1n1c2N=CN\C(=N/N)\c2cc1 |
InChI: |
InChI=1/C11H15N5O4/c12-15-9-5-1-2-16(10(5)14-4-13-9)11-8(19)7(18)6(3-17)20-11/h1-2,4,6-8,11,17-19H,3,12H2,(H,13,14,15)/t6-,7+,8-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.272 g/mol | logS: -0.4815 | SlogP: -1.9216 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0658085 | Sterimol/B1: 2.84556 | Sterimol/B2: 2.98215 | Sterimol/B3: 3.75336 |
Sterimol/B4: 6.06506 | Sterimol/L: 12.6619 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 468.691 | Positive charged surface: 333.41 | Negative charged surface: 135.282 | Volume: 240.5 |
Hydrophobic surface: 162.761 | Hydrophilic surface: 305.93 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |