 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(Cc1ccccc1)C1=N\C(\Nc2n(cnc12)C1OC(CO)C(O)C1[O-])=N\O |
| InChI: | InChI=1/C17H18N5O5S/c23-6-10-12(24)13(25)16(27-10)22-8-18-11-14(22)19-17(21-26)20-15(11)28-7-9-4-2-1-3-5-9/h1-5,8,10,12-13,16,23-24,26H,6-7H2,(H,19,20,21)/q-1/t10-,12+,13-,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=76.0127 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.427 g/mol | logS: -3.42093 | SlogP: 1.1454 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0494224 | Sterimol/B1: 3.21667 | Sterimol/B2: 3.60107 | Sterimol/B3: 4.02187 | |||
| Sterimol/B4: 7.47754 | Sterimol/L: 18.7183 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 634.89 | Positive charged surface: 385.314 | Negative charged surface: 249.575 | Volume: 344.375 | |||
| Hydrophobic surface: 376.729 | Hydrophilic surface: 258.161 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
