Type: Neutral
Formula: C11H13BrN4O5
SMILES: |
Brc1c/2c(n(c1)C1OC(CO)C(O)C1O)N=CN\C\2=N/O |
InChI: |
InChI=1/C11H13BrN4O5/c12-4-1-16(10-6(4)9(15-20)13-3-14-10)11-8(19)7(18)5(2-17)21-11/h1,3,5,7-8,11,17-20H,2H2,(H,13,14,15)/t5-,7+,8-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 361.152 g/mol | logS: -1.20642 | SlogP: -0.6436 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0696608 | Sterimol/B1: 3.2964 | Sterimol/B2: 3.42576 | Sterimol/B3: 4.21712 |
Sterimol/B4: 5.6816 | Sterimol/L: 12.7315 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 490.358 | Positive charged surface: 308.687 | Negative charged surface: 181.671 | Volume: 260.75 |
Hydrophobic surface: 209.315 | Hydrophilic surface: 281.043 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |