 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(NC(=O)CCC([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-])CCCc1ccccc1 |
| InChI: | InChI=1/C19H27N3O6S/c20-14(19(27)28)8-9-16(23)22-15(18(26)21-11-17(24)25)12-29-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,14-15H,4,7-12,20H2,(H,21,26)(H,22,23)(H,24,25)(H,27,28)/p-1/t14-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=59.2945 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.498 g/mol | logS: -3.22194 | SlogP: -3.15613 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0526953 | Sterimol/B1: 3.18688 | Sterimol/B2: 4.1907 | Sterimol/B3: 4.34148 | |||
| Sterimol/B4: 11.5155 | Sterimol/L: 20.0024 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 759.4 | Positive charged surface: 452.208 | Negative charged surface: 307.192 | Volume: 390.25 | |||
| Hydrophobic surface: 419.475 | Hydrophilic surface: 339.925 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
