 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(NC(=O)CCC([NH3+])C(=O)[O-])C(=O)NCC(=O)[O-])CCC(=O)c1cc ccc1 |
| InChI: | InChI=1/C19H25N3O7S/c20-13(19(28)29)6-7-16(24)22-14(18(27)21-10-17(25)26)11-30-9-8-15(23)12-4-2-1-3-5-12/h1-5,13-14H,6-11,20H2,(H,21,27)(H,22,24)(H,25,26)(H,28,29)/p-1/t13-,14+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=67.0066 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 438.481 g/mol | logS: -3.17197 | SlogP: -3.5159 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0424711 | Sterimol/B1: 3.25432 | Sterimol/B2: 3.80367 | Sterimol/B3: 4.31417 | |||
| Sterimol/B4: 12.1917 | Sterimol/L: 19.7066 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 758.227 | Positive charged surface: 436.021 | Negative charged surface: 322.206 | Volume: 395.75 | |||
| Hydrophobic surface: 388.962 | Hydrophilic surface: 369.265 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
