Type: Neutral
Formula: C10H15N3O4
SMILES: |
O1C(CO)C(N)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C10H15N3O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4,11H2,1H3,(H,12,15,16)/t6-,7-,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 241.247 g/mol | logS: -0.18681 | SlogP: -1.1234 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0966865 | Sterimol/B1: 2.55755 | Sterimol/B2: 2.95159 | Sterimol/B3: 3.77777 |
Sterimol/B4: 6.8943 | Sterimol/L: 11.7951 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 428.362 | Positive charged surface: 295.427 | Negative charged surface: 132.934 | Volume: 209.75 |
Hydrophobic surface: 203.448 | Hydrophilic surface: 224.914 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |