Type: Neutral
Formula: C9H16N2O7
SMILES: |
O1C(C(=O)N)C(O)C(O)C(O)C1NC(OCC)=O |
InChI: |
InChI=1/C9H16N2O7/c1-2-17-9(16)11-8-5(14)3(12)4(13)6(18-8)7(10)15/h3-6,8,12-14H,2H2,1H3,(H2,10,15)(H,11,16)/t3-,4+,5+,6-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 264.234 g/mol | logS: -0.01029 | SlogP: -2.9746 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120522 | Sterimol/B1: 2.69211 | Sterimol/B2: 4.30858 | Sterimol/B3: 4.41921 |
Sterimol/B4: 5.59372 | Sterimol/L: 13.2431 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 467.024 | Positive charged surface: 318.726 | Negative charged surface: 148.298 | Volume: 221 |
Hydrophobic surface: 162.187 | Hydrophilic surface: 304.837 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |