 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(CC(NC(=O)C(NC(OCc1ccccc1)=O)Cc1ccccc1)C(=O)[O-])CC |
| InChI: | InChI=1/C22H26N2O5S/c1-2-30-15-19(21(26)27)23-20(25)18(13-16-9-5-3-6-10-16)24-22(28)29-14-17-11-7-4-8-12-17/h3-12,18-19H,2,13-15H2,1H3,(H,23,25)(H,24,28)(H,26,27)/p-1/t18-,19+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=58.4927 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 429.517 g/mol | logS: -5.18515 | SlogP: 1.77827 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.180067 | Sterimol/B1: 2.06439 | Sterimol/B2: 4.81593 | Sterimol/B3: 7.38311 | |||
| Sterimol/B4: 8.87436 | Sterimol/L: 17.3085 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 738.072 | Positive charged surface: 432.166 | Negative charged surface: 305.906 | Volume: 407.625 | |||
| Hydrophobic surface: 537.436 | Hydrophilic surface: 200.636 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
