Type: Neutral
Formula: C11H16N2O6
SMILES: |
O1C(C)C(O)C(O)C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O6/c1-4-3-13(11(18)12-9(4)17)10-8(16)7(15)6(14)5(2)19-10/h3,5-8,10,14-16H,1-2H3,(H,12,17,18)/t5-,6+,7+,8+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.257 g/mol | logS: -0.21581 | SlogP: -1.7305 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.111821 | Sterimol/B1: 2.78067 | Sterimol/B2: 2.97658 | Sterimol/B3: 3.82239 |
Sterimol/B4: 6.24302 | Sterimol/L: 12.2828 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.765 | Positive charged surface: 306.198 | Negative charged surface: 143.567 | Volume: 233 |
Hydrophobic surface: 215.176 | Hydrophilic surface: 234.589 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |