 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(N(CCCc1nc2c(nc1)N=C(NC2=O)N)c1ccc(cc1)C(O)=O)c1ccc (cc1)C |
| InChI: | InChI=1/C23H22N6O5S/c1-14-4-10-18(11-5-14)35(33,34)29(17-8-6-15(7-9-17)22(31)32)12-2-3-16-13-25-20-19(26-16)21(30)28-23(24)27-20/h4-11,13H,2-3,12H2,1H3,(H,31,32)(H3,24,25,27,28,30) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=102.931 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 494.532 g/mol | logS: -4.45136 | SlogP: 2.00089 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0723578 | Sterimol/B1: 2.39071 | Sterimol/B2: 4.12552 | Sterimol/B3: 4.80011 | |||
| Sterimol/B4: 11.8734 | Sterimol/L: 20.3343 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 754.377 | Positive charged surface: 443.589 | Negative charged surface: 310.788 | Volume: 425.625 | |||
| Hydrophobic surface: 400.606 | Hydrophilic surface: 353.771 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
