 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S=C1N=CNc2n(cnc12)C1OC(COP(Oc2ccccc2)(O)=O)C(O)C1[O-] |
| InChI: | InChI=1/C16H16N4O7PS/c21-12-10(6-25-28(23,24)27-9-4-2-1-3-5-9)26-16(13(12)22)20-8-19-11-14(20)17-7-18-15(11)29/h1-5,7-8,10,12-13,16,21H,6H2,(H,23,24)(H,17,18,29)/q-1/t10-,12-,13-,16+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=36.7669 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 439.365 g/mol | logS: -3.77437 | SlogP: 0.2911 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0311243 | Sterimol/B1: 3.25629 | Sterimol/B2: 3.84366 | Sterimol/B3: 5.18528 | |||
| Sterimol/B4: 5.24179 | Sterimol/L: 20.0586 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 652.889 | Positive charged surface: 347.874 | Negative charged surface: 305.015 | Volume: 352.375 | |||
| Hydrophobic surface: 366.3 | Hydrophilic surface: 286.589 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 9 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
