Type: Neutral
Formula: C12H19N5O5
SMILES: |
OC(C(O)C(O)CO)C(O)CNc1ncnc2n(ncc12)C |
InChI: |
InChI=1/C12H19N5O5/c1-17-12-6(2-16-17)11(14-5-15-12)13-3-7(19)9(21)10(22)8(20)4-18/h2,5,7-10,18-22H,3-4H2,1H3,(H,13,14,15)/t7-,8+,9-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 313.314 g/mol | logS: -0.32399 | SlogP: -2.4297 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0323803 | Sterimol/B1: 2.89809 | Sterimol/B2: 3.22601 | Sterimol/B3: 3.58454 |
Sterimol/B4: 5.15165 | Sterimol/L: 18.8149 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 548.529 | Positive charged surface: 434.146 | Negative charged surface: 108.822 | Volume: 276.625 |
Hydrophobic surface: 279.025 | Hydrophilic surface: 269.504 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |