Type: Neutral
Formula: C10H14N6O2
SMILES: |
O1C(C)C(O)C(N)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C10H14N6O2/c1-4-7(17)5(11)10(18-4)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17H,11H2,1H3,(H2,12,13,14)/t4-,5+,7-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 250.262 g/mol | logS: -1.38633 | SlogP: -0.8905 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0895015 | Sterimol/B1: 2.5564 | Sterimol/B2: 2.61412 | Sterimol/B3: 4.37507 |
Sterimol/B4: 5.65768 | Sterimol/L: 13.825 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.848 | Positive charged surface: 345.483 | Negative charged surface: 102.365 | Volume: 221.375 |
Hydrophobic surface: 171.771 | Hydrophilic surface: 276.077 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |