Type: Neutral
Formula: C10H12N4O5
SMILES: |
O1C(C(O)C(O)C1CO)c1n[nH]c2c1N=CNC2=O |
InChI: |
InChI=1/C10H12N4O5/c15-1-3-7(16)8(17)9(19-3)5-4-6(14-13-5)10(18)12-2-11-4/h2-3,7-9,15-17H,1H2,(H,13,14)(H,11,12,18)/t3-,7+,8+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.229 g/mol | logS: -0.48703 | SlogP: -1.9376 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130223 | Sterimol/B1: 2.3865 | Sterimol/B2: 3.01399 | Sterimol/B3: 5.1244 |
Sterimol/B4: 5.41258 | Sterimol/L: 13.3696 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.188 | Positive charged surface: 329.176 | Negative charged surface: 118.012 | Volume: 216.125 |
Hydrophobic surface: 137.121 | Hydrophilic surface: 310.067 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |