 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC(=Nc2ncc(nc12)NCc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N |
| InChI: | InChI=1/C19H19N7O6/c20-19-25-15-14(17(30)26-19)24-12(8-22-15)21-7-9-1-3-10(4-2-9)16(29)23-11(18(31)32)5-6-13(27)28/h1-4,8,11H,5-7H2,(H,21,24)(H,23,29)(H,27,28)(H,31,32)(H3,20,22,25,26,30)/t11-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=61.2594 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 441.404 g/mol | logS: -2.18368 | SlogP: 0.0925 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0397641 | Sterimol/B1: 2.36471 | Sterimol/B2: 5.1721 | Sterimol/B3: 5.41171 | |||
| Sterimol/B4: 5.96305 | Sterimol/L: 21.9136 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 715.476 | Positive charged surface: 442.481 | Negative charged surface: 272.995 | Volume: 375.25 | |||
| Hydrophobic surface: 248.937 | Hydrophilic surface: 466.539 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
