Type: Neutral
Formula: C16H31N3O4S
SMILES: |
S(CCC(NC(=O)C(NC(OC(C)(C)C)=O)C(CC)C)C(=O)N)C |
InChI: |
InChI=1/C16H31N3O4S/c1-7-10(2)12(19-15(22)23-16(3,4)5)14(21)18-11(13(17)20)8-9-24-6/h10-12H,7-9H2,1-6H3,(H2,17,20)(H,18,21)(H,19,22)/t10-,11-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 361.507 g/mol | logS: -3.71231 | SlogP: 1.649 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0803093 | Sterimol/B1: 1.969 | Sterimol/B2: 2.49905 | Sterimol/B3: 5.57049 |
Sterimol/B4: 8.50548 | Sterimol/L: 17.2056 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 647.51 | Positive charged surface: 425.66 | Negative charged surface: 221.85 | Volume: 356.875 |
Hydrophobic surface: 373.439 | Hydrophilic surface: 274.071 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |