 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(C1[NH+](C1c1ccccc1)C1CCCCC1)(c1ccc(cc1)C)c1ccccc1 |
| InChI: | InChI=1/C28H31NO/c1-21-17-19-24(20-18-21)28(30,23-13-7-3-8-14-23)27-26(22-11-5-2-6-12-22)29(27)25-15-9-4-10-16-25/h2-3,5-8,11-14,17-20,25-27,30H,4,9-10,15-16H2,1H3/p+1/t26-,27+,28+,29+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.021 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 398.57 g/mol | logS: -6.6591 | SlogP: 4.97902 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.284541 | Sterimol/B1: 2.65201 | Sterimol/B2: 4.11101 | Sterimol/B3: 8.29912 | |||
| Sterimol/B4: 8.85097 | Sterimol/L: 15.7937 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 691.524 | Positive charged surface: 444.221 | Negative charged surface: 247.303 | Volume: 432.75 | |||
| Hydrophobic surface: 668.123 | Hydrophilic surface: 23.401 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
