Type: Neutral
Formula: C13H19N3O5S2
SMILES: |
S(=O)(CC(NC(=O)\C=C\C=1C(=O)NC(=O)NC=1C)CO)CSC |
InChI: |
InChI=1/C13H19N3O5S2/c1-8-10(12(19)16-13(20)14-8)3-4-11(18)15-9(5-17)6-23(21)7-22-2/h3-4,9,17H,5-7H2,1-2H3,(H,15,18)(H2,14,16,19,20)/b4-3+/t9-,23+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 361.443 g/mol | logS: -2.16268 | SlogP: -0.7977 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100114 | Sterimol/B1: 2.21715 | Sterimol/B2: 5.433 | Sterimol/B3: 5.66158 |
Sterimol/B4: 6.13566 | Sterimol/L: 17.162 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 602.241 | Positive charged surface: 365.595 | Negative charged surface: 236.646 | Volume: 308.25 |
Hydrophobic surface: 303.951 | Hydrophilic surface: 298.29 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |