 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)C(=O)CSc1nc(nc2n(cnc12)C1OC(CO)C(O)C1[O-])N |
| InChI: | InChI=1/C18H17ClN5O5S/c19-9-3-1-8(2-4-9)10(26)6-30-16-12-15(22-18(20)23-16)24(7-21-12)17-14(28)13(27)11(5-25)29-17/h1-4,7,11,13-14,17,25,27H,5-6H2,(H2,20,22,23)/q-1/t11-,13+,14-,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=63.5137 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.883 g/mol | logS: -5.49088 | SlogP: 1.1821 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0490161 | Sterimol/B1: 2.85059 | Sterimol/B2: 3.74155 | Sterimol/B3: 4.26832 | |||
| Sterimol/B4: 6.89965 | Sterimol/L: 20.7619 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 691.267 | Positive charged surface: 374.005 | Negative charged surface: 317.262 | Volume: 371.25 | |||
| Hydrophobic surface: 370.9 | Hydrophilic surface: 320.367 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
