Type: Neutral
Formula: C11H21NO6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)CCCC)C1O |
InChI: |
InChI=1/C11H21NO6/c1-2-3-4-7(14)12-8-10(16)9(15)6(5-13)18-11(8)17/h6,8-11,13,15-17H,2-5H2,1H3,(H,12,14)/t6-,8+,9+,10-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 263.29 g/mol | logS: -0.36473 | SlogP: -1.9073 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.120438 | Sterimol/B1: 3.16765 | Sterimol/B2: 3.95044 | Sterimol/B3: 4.50859 |
Sterimol/B4: 4.50903 | Sterimol/L: 15.2543 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 494.871 | Positive charged surface: 388.136 | Negative charged surface: 106.735 | Volume: 241 |
Hydrophobic surface: 269.38 | Hydrophilic surface: 225.491 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |