 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Fc1cc(ccc1NCc1nc2c(nc1)N=C(NC2=O)N)C(=O)NC(CCC(=O)[O-])C(=O) [O-] |
| InChI: | InChI=1/C19H18FN7O6/c20-10-5-8(16(30)25-12(18(32)33)3-4-13(28)29)1-2-11(10)22-6-9-7-23-15-14(24-9)17(31)27-19(21)26-15/h1-2,5,7,12,22H,3-4,6H2,(H,25,30)(H,28,29)(H,32,33)(H3,21,23,26,27,31)/p-2/t12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=86.0119 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 457.378 g/mol | logS: -2.84122 | SlogP: -2.4378 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0441067 | Sterimol/B1: 2.29964 | Sterimol/B2: 2.78936 | Sterimol/B3: 5.93856 | |||
| Sterimol/B4: 6.72628 | Sterimol/L: 21.2117 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 712.798 | Positive charged surface: 388.147 | Negative charged surface: 324.651 | Volume: 379.25 | |||
| Hydrophobic surface: 261.881 | Hydrophilic surface: 450.917 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
